CymitQuimica logo

CAS 181819-52-3

:

2,4-Diethoxybenzenemethanol

Description:
2,4-Diethoxybenzenemethanol is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two ethoxy groups and a hydroxymethyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the ethoxy groups. The presence of the hydroxymethyl group contributes to its potential reactivity, allowing for various chemical transformations, such as etherification or oxidation. 2,4-Diethoxybenzenemethanol may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its functional groups that can participate in further chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a versatile building block in organic chemistry with potential applications in various fields.
Formula:C11H16O3
InChI:InChI=1S/C11H16O3/c1-3-13-10-6-5-9(8-12)11(7-10)14-4-2/h5-7,12H,3-4,8H2,1-2H3
InChI key:InChIKey=GVURYEOXXOUZQP-UHFFFAOYSA-N
SMILES:O(CC)C1=C(CO)C=CC(OCC)=C1
Synonyms:
  • Benzenemethanol, 2,4-diethoxy-
  • 2,4-Diethoxybenzenemethanol
  • (2,4-Diethoxyphenyl)methanol
  • 2,4-Diethoxybenzyl alcohol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.