
CAS 1818218-33-5
:1-(5-Amino-1H-imidazol-4-yl)-8-methyl-1-nonanone
Description:
1-(5-Amino-1H-imidazol-4-yl)-8-methyl-1-nonanone, identified by its CAS number 1818218-33-5, is a chemical compound that features a complex structure incorporating an imidazole ring and a nonanone moiety. This compound is characterized by the presence of an amino group, which contributes to its potential reactivity and biological activity. The imidazole ring is known for its role in various biochemical processes, often serving as a building block in pharmaceuticals and biologically active molecules. The presence of the methyl group and the nonanone chain suggests that this compound may exhibit hydrophobic characteristics, influencing its solubility and interaction with biological membranes. Additionally, the structural features may impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, the compound's unique combination of functional groups and structural elements positions it as a candidate for further research in drug development and related fields.
Formula:C13H23N3O
InChI:InChI=1S/C13H23N3O/c1-10(2)7-5-3-4-6-8-11(17)12-13(14)16-9-15-12/h9-10H,3-8,14H2,1-2H3,(H,15,16)
InChI key:InChIKey=WMNFVUHNJUDHER-UHFFFAOYSA-N
SMILES:C(CCCCCCC(C)C)(=O)C1=C(N)N=CN1
Synonyms:- Nocarimidazole A
- 1-Nonanone, 1-(5-amino-1H-imidazol-4-yl)-8-methyl-
- 1-(5-Amino-1H-imidazol-4-yl)-8-methyl-1-nonanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nocarimidazole A
CAS:Nocarimidazole A, a white amorphous solid alkaloid exhibiting ultraviolet activity, can be isolated from the marine actinomycete Nocardiopsis [1] [2].Formula:C13H23N3OColor and Shape:SolidMolecular weight:237.34
