CAS 1818294-28-8
:4,7,10,13,16,19,22-Heptaoxatetracos-23-ynoic acid
Description:
4,7,10,13,16,19,22-Heptaoxatetracos-23-ynoic acid is a complex organic compound characterized by its long carbon chain and multiple oxygen functionalities. This substance features a total of seven ether or ester linkages, which contribute to its unique chemical properties, including solubility and reactivity. The presence of a terminal alkyne group indicates that it can participate in various chemical reactions, such as nucleophilic additions or coupling reactions. The systematic name reflects the compound's structure, which includes a long carbon backbone with alternating functional groups. Its molecular structure suggests potential applications in materials science, particularly in the development of polymers or surfactants due to its amphiphilic nature. Additionally, the compound may exhibit interesting biological properties, making it a candidate for further research in medicinal chemistry. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical investigation or literature references for comprehensive understanding.
Formula:C17H30O9
InChI:InChI=1S/C17H30O9/c1-2-20-5-6-22-9-10-24-13-14-26-16-15-25-12-11-23-8-7-21-4-3-17(18)19/h1H,3-16H2,(H,18,19)
InChI key:InChIKey=IMAFNSCBGNDTPX-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCOC#C)OCCOCCC(O)=O
Synonyms:- 4,7,10,13,16,19,22-Heptaoxatetracos-23-ynoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
