CymitQuimica logo

CAS 1818294-49-3

:

2,3,5,6-Tetrafluorophenyl 3-[(23-azido-3,6,9,12,15,18,21-heptaoxatricos-1-yl)oxy]propanoate

Description:
2,3,5,6-Tetrafluorophenyl 3-[(23-azido-3,6,9,12,15,18,21-heptaoxatricos-1-yl)oxy]propanoate is a complex organic compound characterized by its unique structural features, including a tetrafluorophenyl group and an azido-functionalized heptaoxatricos moiety. The presence of fluorine atoms enhances the compound's lipophilicity and stability, while the azido group provides potential for further chemical modifications, particularly in click chemistry applications. The heptaoxatricos segment contributes to the compound's solubility and may influence its biological activity. This compound is likely to exhibit interesting properties due to the combination of its fluorinated aromatic system and the polyether structure, which can affect its interaction with biological membranes and other molecular targets. Additionally, the azido group can serve as a handle for bioconjugation, making it a candidate for applications in drug delivery or imaging. Overall, this compound's unique characteristics make it a subject of interest in both synthetic chemistry and potential biomedical applications.
Formula:C25H37F4N3O10
InChI:InChI=1S/C25H37F4N3O10/c26-20-19-21(27)24(29)25(23(20)28)42-22(33)1-3-34-5-7-36-9-11-38-13-15-40-17-18-41-16-14-39-12-10-37-8-6-35-4-2-31-32-30/h19H,1-18H2
InChI key:InChIKey=ICPUCGMOWKDMAI-UHFFFAOYSA-N
SMILES:O(C(CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O)C1=C(F)C(F)=CC(F)=C1F
Synonyms:
  • Propanoic acid, 3-[(23-azido-3,6,9,12,15,18,21-heptaoxatricos-1-yl)oxy]-, 2,3,5,6-tetrafluorophenyl ester
  • 2,3,5,6-Tetrafluorophenyl 3-[(23-azido-3,6,9,12,15,18,21-heptaoxatricos-1-yl)oxy]propanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.