CymitQuimica logo

CAS 1818847-43-6

:

3-Azetidinone, 1-methyl-, hydrochloride (1:1)

Description:
3-Azetidinone, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its azetidinone structure, which features a four-membered lactam ring. This compound typically exhibits properties associated with both amides and cyclic compounds, including potential biological activity. The presence of the methyl group at the nitrogen atom enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is often more soluble in water compared to its free base form, facilitating its use in various applications, particularly in pharmaceutical formulations. The hydrochloride form can also enhance stability and improve the handling characteristics of the compound. In terms of safety, like many chemical substances, it should be handled with care, following appropriate safety guidelines to mitigate any potential hazards. Overall, 3-Azetidinone, 1-methyl-, hydrochloride (1:1) represents a compound of interest in medicinal chemistry, potentially serving as a precursor or active ingredient in drug development.
Formula:C4H7NO·ClH
InChI:InChI=1S/C4H7NO.ClH/c1-5-2-4(6)3-5;/h2-3H2,1H3;1H
InChI key:InChIKey=GALUYBXZFLBDAA-UHFFFAOYSA-N
SMILES:O=C1CN(C)C1.Cl
Synonyms:
  • 3-Azetidinone, 1-methyl-, hydrochloride (1:1)
Found 5 products.