CAS 1818847-83-4

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-2,3-dihydro-, hydrochloride (1:1)

Description:

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which includes a pyrrole and a pyridine ring fused together. The presence of a chlorine atom at the 4-position of the pyrrolo ring contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and it may be investigated for its role in drug development. The compound's CAS number, 1818847-83-4, facilitates its identification in chemical databases and literature. Overall, 1H-Pyrrolo[2,3-b]pyridine derivatives are studied for their diverse applications, particularly in the fields of organic synthesis and medicinal chemistry.

Formula: C₇H₇ClN₂·ClH

InChI: InChI=1S/C7H7ClN2.ClH/c8-6-2-4-10-7-5(6)1-3-9-7;/h2,4H,1,3H2,(H,9,10);1H

InChI key: InChIKey=WOPVUMXNWHUJBT-UHFFFAOYSA-N

SMILES: ClC1=C2C(=NC=C1)NCC2.Cl

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-2,3-dihydro-, hydrochloride (1:1)

1H-Pyrrolo[2,3-b]pyridine, 4-chloro-2,3-dihydro-, hydrochloride (1:1)

CAS: 1818847-83-4

Formula: C₇H₈Cl₂N₂

Purity: 97%

Molecular weight: 191.0578

Ref: IN-DA00236P

4-CHLORO-1H,2H,3H-PYRROLO[2,3-B]PYRIDINE HCL

CAS: 1818847-83-4

Formula: C₇H₈Cl₂N₂

Purity: 97%

Molecular weight: 191.06

Ref: 10-F513385