
CAS 18189-07-6
:Decyl 2-aminobenzoate
Description:
Decyl 2-aminobenzoate, with the CAS number 18189-07-6, is an organic compound characterized by its structure, which includes a decyl chain and an aminobenzoate moiety. This substance typically appears as a colorless to pale yellow liquid and is known for its solubility in organic solvents while being less soluble in water. It exhibits properties that make it useful in various applications, particularly in the fields of cosmetics and pharmaceuticals, where it may serve as an emulsifier or a skin-conditioning agent. The presence of the amino group contributes to its potential reactivity and ability to form hydrogen bonds, enhancing its functionality in formulations. Additionally, the decyl group imparts hydrophobic characteristics, influencing the compound's behavior in different environments. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, Decyl 2-aminobenzoate is valued for its unique combination of hydrophilic and hydrophobic properties, making it versatile in various chemical applications.
Formula:C17H27NO2
InChI:InChI=1S/C17H27NO2/c1-2-3-4-5-6-7-8-11-14-20-17(19)15-12-9-10-13-16(15)18/h9-10,12-13H,2-8,11,14,18H2,1H3
InChI key:InChIKey=NMXZJPNAJUDMAC-UHFFFAOYSA-N
SMILES:C(OCCCCCCCCCC)(=O)C1=C(N)C=CC=C1
Synonyms:- Decyl anthranilate
- Decyl 2-aminobenzoate
- Benzoic acid, 2-amino-, decyl ester
- Anthranilic acid, decyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
