CAS 18189-19-0
:1-[4-(Bromomethyl)phenyl]-2-phenyl-1,2-ethanedione
Description:
1-[4-(Bromomethyl)phenyl]-2-phenyl-1,2-ethanedione, with CAS number 18189-19-0, is an organic compound characterized by its complex structure, which includes a bromomethyl group and two phenyl rings attached to a diketone moiety. This compound typically exhibits a yellow to orange color in solid form and is likely to be soluble in organic solvents due to its aromatic character. The presence of the bromomethyl group suggests potential reactivity, making it a candidate for further chemical transformations, such as nucleophilic substitution reactions. The diketone functional groups contribute to its potential applications in organic synthesis and materials science. Additionally, the compound may exhibit interesting photophysical properties, which could be explored for use in dyes or fluorescent materials. Safety precautions should be taken when handling this compound, as brominated compounds can pose health risks. Overall, its unique structure and functional groups make it a valuable compound for research in organic chemistry and related fields.
Formula:C15H11BrO2
InChI:InChI=1S/C15H11BrO2/c16-10-11-6-8-13(9-7-11)15(18)14(17)12-4-2-1-3-5-12/h1-9H,10H2
InChI key:InChIKey=QELAVTMDKHSMOP-UHFFFAOYSA-N
SMILES:C(C(=O)C1=CC=CC=C1)(=O)C2=CC=C(CBr)C=C2
Synonyms:- (4-(Bromomethyl)phenyl)phenylethanedione
- 1,2-Ethanedione, 1-[4-(bromomethyl)phenyl]-2-phenyl-
- 1-[4-(Bromomethyl)Phenyl]-2-Phenylethane-1,2-Dione
- 1-[4-(Bromomethyl)phenyl]-2-phenyl-1,2-ethanedione
- 4-(Bromomethyl)benzil
- Benzil, 4-(bromomethyl)-
- Ethanedione, [4-(bromomethyl)phenyl]phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2-Ethanedione, 1-[4-(bromomethyl)phenyl]-2-phenyl-
CAS:Formula:C15H11BrO2Color and Shape:SolidMolecular weight:303.15064-(Bromomethyl)benzil
CAS:4-(Bromomethyl)benzilPurity:≥95%Color and Shape:Yellow SolidMolecular weight:303.15g/mol4-Bromomethylbenzil
CAS:Controlled ProductStability Moisture Sensitive
Applications 4-Bromomethylbenzil (cas# 18189-19-0) is a compound useful in organic synthesis.Formula:C15H11BrO2Color and Shape:NeatMolecular weight:303.154-Bromomethylbenzil
CAS:4-Bromomethylbenzil is a molecule that can be synthesized by the Friedel-Crafts acylation reaction of 4-bromoanisole and benzaldehyde. It has two bimodal photophysical properties, which are different in absorption and emission spectra. This molecule has a low viscosity (0.1 cP), which is due to its high molecular weight. The activation energies for this molecule are found to be very similar to those of anthracene, but the chloride ion is not necessary for it to react with tetrahydrofuran as it does for anthracene. The constant for this compound is found to be 0.15 M at 25 degrees Celsius, and the logarithm of the partition coefficient between water and octanol is found to be 1.58 at pH 7 and 10 degrees Celsius.Formula:C15H11BrO2Purity:Min. 95%Molecular weight:303.15 g/mol



