CAS 181950-57-2
:4-Chloro-7-hydroxyquinoline
Description:
4-Chloro-7-hydroxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 4-position and a hydroxyl group at the 7-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly as an antimicrobial or antifungal agent. Its molecular structure allows for various interactions, including hydrogen bonding due to the hydroxyl group, which can enhance its solubility in polar solvents. Additionally, the chlorine substituent can influence the compound's reactivity and biological activity. The compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many chemical substances, safety precautions should be observed when handling 4-Chloro-7-hydroxyquinoline, as it may pose health risks if ingested or inhaled.
Formula:C9H6ClNO
InChI:InChI=1/C9H6ClNO/c10-8-3-4-11-9-5-6(12)1-2-7(8)9/h1-5,12H
SMILES:c1cc2c(ccnc2cc1O)Cl
Synonyms:- 4-Chloroquinolin-7-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-7-hydroxyquinoline
CAS:Formula:C9H6ClNOPurity:98%Color and Shape:SolidMolecular weight:179.64-Chloro-7-hydroxyquinoline
CAS:4-Chloro-7-hydroxyquinoline is a quinoline derivative that has shown potential as an antitumor agent. It activates transcription of tumor suppressor genes and causes apoptosis in cancer cells. 4-Chloro-7-hydroxyquinoline has been found to be effective against several human cancer cell lines, including prostate, breast, and lung cancer cells, but not against normal cell lines. This drug also shows antiproliferative properties in vivo. In a xenograft model using mice, 4-chloro-7-hydroxyquinoline inhibited tumor growth and reduced the size of tumors by 75% after six weeks of treatment. The drug also showed potent antiproliferative activity on human tumor cell lines.Purity:Min. 95%



