CAS 181956-25-2

1-BENZYL-4-BOC-PIPERAZINE-2-CARBOXYLIC ACID

Description:

1-Benzyl-4-BOC-piperazine-2-carboxylic acid is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a benzyl group enhances its lipophilicity, potentially influencing its biological activity and solubility. The tert-butyloxycarbonyl (BOC) group serves as a protecting group for the amine, making it useful in synthetic chemistry for the selective modification of functional groups. The carboxylic acid moiety contributes to the compound's acidity and can participate in various chemical reactions, such as esterification or amidation. This compound is often utilized in medicinal chemistry and drug development due to its structural features that may interact with biological targets. Its CAS number, 181956-25-2, allows for precise identification in chemical databases and literature. Overall, the combination of these functional groups makes 1-benzyl-4-BOC-piperazine-2-carboxylic acid a versatile intermediate in organic synthesis and pharmaceutical research.

Formula: C₁₇H₂₄N₂O₄

InChI: InChI=1/C17H24N2O4/c1-17(2,3)23-16(22)19-10-9-18(14(12-19)15(20)21)11-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,20,21)

SMILES: CC(C)(C)OC(=O)N1CCN(Cc2ccccc2)C(C1)C(=O)O

Synonyms:

• 1,3-Piperazinedicarboxylic acid, 4-(phenylmethyl)-, 1-(1,1-dimethylethyl) ester
• 1-Benzyl-4-(tert-butoxycarbonyl)piperazine-2-carboxylic acid

1-Benzyl-4-(tert-Butoxycarbonyl)piperazine-2-carboxylicacid

CAS: 181956-25-2

Formula: C₁₇H₂₄N₂O₄

Molecular weight: 320.3835

Ref: IN-DA00238S