CAS 18198-39-5
:Tetraphenylphosphonium
Description:
Tetraphenylphosphonium is a quaternary ammonium salt characterized by its tetrahedral phosphorus atom bonded to four phenyl groups. It is typically represented by the formula [P(C6H5)4]+, indicating its cationic nature, often paired with an anion such as bromide or chloride. This compound is known for its stability and solubility in organic solvents, making it useful in various chemical applications, including as a phase transfer catalyst and in organic synthesis. Tetraphenylphosphonium exhibits interesting electrochemical properties and can participate in redox reactions, often serving as a source of phosphonium ions in organic reactions. Its solid form is usually white to light yellow, and it has a relatively high melting point. Additionally, it is non-volatile and has low toxicity, although handling should still be done with care due to potential irritant properties. Overall, tetraphenylphosphonium is a versatile compound in organic chemistry, particularly in the synthesis of other phosphonium derivatives and in catalysis.
Formula:C24H20P
InChI:InChI=1S/C24H20P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H/q+1
InChI key:InChIKey=USFPINLPPFWTJW-UHFFFAOYSA-N
SMILES:[P+](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- Tetraphenylphosphonium ion
- Tetraphenylphosphonium cation
- Phosphonium, tetraphenyl-
- Tetraphenylphosphonium ion(1+)
- Tetraphenylphosphonium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
