CAS 182-53-6
:3H-spiro[1,3-benzothiazole-2,1'-cyclohexane]
Description:
3H-spiro[1,3-benzothiazole-2,1'-cyclohexane], with the CAS number 182-53-6, is a heterocyclic compound characterized by its unique spiro structure, which consists of a benzothiazole moiety fused to a cyclohexane ring. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and materials science. The presence of the benzothiazole group imparts specific electronic properties, making it of interest in the development of organic semiconductors and fluorescent materials. Additionally, the spiro configuration can influence the compound's reactivity and stability, often leading to interesting chemical behavior. Its solubility can vary depending on the solvent, and it may exhibit fluorescence under certain conditions. Overall, 3H-spiro[1,3-benzothiazole-2,1'-cyclohexane] is a compound of interest in both academic research and industrial applications due to its structural uniqueness and potential functional properties.
Formula:C12H15NS
InChI:InChI=1/C12H15NS/c1-4-8-12(9-5-1)13-10-6-2-3-7-11(10)14-12/h2-3,6-7,13H,1,4-5,8-9H2
SMILES:C1CCC2(CC1)Nc1ccccc1S2
Synonyms:- spiro[benzothiazole-2(3H),1'-cyclohexane]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
