CAS 1820-59-3
:2,2′,4,4′-Tetranitro-1,1′-biphenyl
Description:
2,2′,4,4′-Tetranitro-1,1′-biphenyl, with the CAS number 1820-59-3, is a chemical compound known for its high explosive properties. It is characterized by the presence of four nitro groups attached to a biphenyl structure, which significantly enhances its sensitivity and stability compared to other nitro compounds. This compound typically appears as a yellow crystalline solid and is insoluble in water, but soluble in organic solvents. Its molecular structure contributes to its energetic characteristics, making it a subject of interest in both military and industrial applications. Due to its explosive nature, it requires careful handling and storage to prevent accidental detonation. Additionally, 2,2′,4,4′-tetranitro-1,1′-biphenyl is often studied for its potential environmental impact and toxicity, as nitroaromatic compounds can pose risks to human health and ecosystems. Overall, its unique properties make it a significant compound in the field of explosives and materials science.
Formula:C12H6N4O8
InChI:InChI=1S/C12H6N4O8/c17-13(18)7-1-3-9(11(5-7)15(21)22)10-4-2-8(14(19)20)6-12(10)16(23)24/h1-6H
InChI key:InChIKey=UDJCKALRMXKDIT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC(N(=O)=O)=C1)C2=C(N(=O)=O)C=C(N(=O)=O)C=C2
Synonyms:- 1,1'-Biphenyl, 2,2',4,4'-tetranitro-
- 1,1′-Biphenyl, 2,2′,4,4′-tetranitro-
- 2,2',4,4'-Tetranitrobiphenyl
- 2,2',4,4'-Tetranitrobiphenyl, 2,2',4,4'-tetranitro-
- 2,2′,4,4′-Tetranitro-1,1′-biphenyl
- 2,2′,4,4′-Tetranitrobiphenyl
- 2,4,2′,4′-Tetranitrobiphenyl
- Ai3-08861
- Biphenyl, 2,2',4,4'-tetranitro- (8CI)
- Biphenyl, 2,2′,4,4′-tetranitro-
- Brn 2020774
- Ccris 4119
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,2',4,4'-Tetranitro-1,1'-biphenyl
CAS:Controlled ProductApplications 2,2',4,4'-Tetranitro-1,1'-biphenyl is an intermediate used in the synthesis of substituted dibenzophospholes.
References Cornforth, J., et al.: J. Chem. Soc. Perkin Transactions 1: Organic and Bio-Organic Chemistry, 10, 2299 (1982)Formula:C12H6N4O8Color and Shape:NeatMolecular weight:334.21,1'-Biphenyl, 2,2',4,4'-tetranitro-
CAS:Formula:C12H6N4O8Color and Shape:SolidMolecular weight:334.1980

