CAS 1820-73-1: L-Glutamic acid, 5-hydrazide
Description:L-Glutamic acid, 5-hydrazide, also known by its CAS number 1820-73-1, is a chemical compound derived from L-glutamic acid, an amino acid that plays a crucial role in cellular metabolism and neurotransmission. This compound features a hydrazide functional group, which is characterized by the presence of a hydrazine (-NH-NH2) moiety attached to the carboxylic acid of glutamic acid. L-Glutamic acid itself is a non-essential amino acid, contributing to protein synthesis and acting as a neurotransmitter in the central nervous system. The hydrazide modification can enhance its reactivity, making it useful in various chemical reactions, including those in medicinal chemistry and biochemistry. L-Glutamic acid, 5-hydrazide may exhibit properties such as solubility in water and potential biological activity, although specific characteristics like melting point, boiling point, and stability can vary based on environmental conditions and the presence of other substances. Its applications may extend to research in drug development and as a biochemical reagent.
Formula:C5H11N3O3
InChI:InChI=1S/C5H11N3O3/c6-3(5(10)11)1-2-4(9)8-7/h3H,1-2,6-7H2,(H,8,9)(H,10,11)/t3-/m0/s1
InChI key:InChIKey=MOFBPUBBBREDCE-VKHMYHEASA-N
SMILES:O=C(O)C(N)CCC(=O)NN
- Synonyms:
- #-L-Glutamylhydrazide
- (2S)-2-Amino-4-(hydrazinecarbonyl)butanoic acid
- (2S)-2-amino-5-hydrazinyl-5-oxopentanoic acid (non-preferred name)
- (S)-2-Amino-5-hydrazinyl-5-oxopentanoic acid
- 2-Amino-5-Hydrazinyl-5-Oxopentanoic Acid (Non-Preferred Name)
- <span class="text-smallcaps">L</span>-Glutamate-γ-hydrazide
- <span class="text-smallcaps">L</span>-Glutamic acid hydrazide
- <span class="text-smallcaps">L</span>-Glutamic acid γ-hydrazide
- <span class="text-smallcaps">L</span>-Glutamic acid, 5-hydrazide
- <span class="text-smallcaps">L</span>-γ-Glutamylhydrazide
- See more synonyms
- Glutamic acid, 5-hydrazide, <span class="text-smallcaps">L</span>-
- L-gamma-glutamylhydrazine
- NSC 7786
- γ-<span class="text-smallcaps">L</span>-Glutamylhydrazide
- γ-Glutamic acid hydrazide
- γ-Glutamyl hydrazide
- L-Glutamate-γ-hydrazide
- L-glutamic acid gamma-hydrazide
- Glutamic acid, 5-hydrazide, L-
- L-Glutamic acid, 5-hydrazide
- L-Glutamic acid γ-hydrazide
- L-γ-Glutamylhydrazide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | gamma-L-Glutamyl hydrazide REF: 02-J67675CAS: 1820-73-1 | - - - | To inquire | Wed 02 Apr 25 |
![]() | L-Glutamic acid, 5-hydrazide REF: IN-DA00239TCAS: 1820-73-1 | - - - | To inquire | Tue 08 Apr 25 |

Ref: 02-J67675
1g | To inquire | ||
5g | To inquire |