CAS 18200-13-0
:N-[2-(2H-tetrazol-5-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-amine
Description:
N-[2-(2H-tetrazol-5-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-amine, with the CAS number 18200-13-0, is a chemical compound characterized by its complex structure, which includes a naphthalene moiety and a tetrazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the tetrazole group may contribute to its ability to form hydrogen bonds and interact with biological targets, potentially influencing its pharmacological properties. Additionally, the naphthalenamine structure may impart certain electronic and steric characteristics that affect its reactivity and stability. As with many organic compounds, its behavior can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific safety and handling guidelines should be followed due to the potential hazards associated with its chemical nature.
Formula:C17H17N5
InChI:InChI=1/C17H17N5/c1-2-8-13-12(6-1)7-5-11-15(13)18-16-10-4-3-9-14(16)17-19-21-22-20-17/h3-5,7,9-11,18H,1-2,6,8H2,(H,19,20,21,22)
SMILES:C1CCc2c(C1)cccc2Nc1ccccc1c1n[nH]nn1
Synonyms:- 1-Naphthalenamine, 5,6,7,8-tetrahydro-N-[2-(2H-tetrazol-5-yl)phenyl]-
- 5,6,7,8-Tetrahydro-N-[2-(2H-tetrazol-5-yl)phenyl]-1-naphthalenamine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Naphthalenamine, 5,6,7,8-tetrahydro-N-[2-(2H-tetrazol-5-yl)phenyl]-
CAS:Formula:C17H17N5Purity:98%Color and Shape:SolidMolecular weight:291.3504BL-1249
CAS:BL-1249 is a selective and potent non-steroidal potassium channel activator with anti-inflammatory activity that activates K2P2.1 (TREK-1) and K2P10.1 (TREK-2).Formula:C17H17N5Purity:98% - 98.25%Color and Shape:SolidMolecular weight:291.35Ref: TM-T14666
1mg50.00€5mg105.00€10mg167.00€25mg245.00€50mg334.00€100mg587.00€500mg1,215.00€1mL*10mM (DMSO)146.00€N-[2-(1H-1,2,3,4-tetrazol-5-yl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-amine
CAS:Purity:98%Molecular weight:291.3580017BL 1249
CAS:BL 1249 is a molecule that belongs to the class of nonsteroidal anti-inflammatory drugs. It has been shown to activate apoptosis in cancer cells, inhibit proliferation and migration of human osteoblasts, and induce membrane hyperpolarization in damaged cells. BL 1249 inhibits the activity of HDACs, which are enzymes that remove acetyl groups from histones and have been implicated in cancer cell growth. BL 1249 also can be used as a nutrient solution for bladder tissue repair in animal models.
Formula:C17H17N5Purity:Min. 95%Molecular weight:291.35 g/mol




