CAS 182008-07-7
:2,2-DIMETHOXY-1,6-DIAZA-2-SILACYCLOOCTANE
Description:
2,2-Dimethoxy-1,6-diaza-2-silacyclooctane is a chemical compound characterized by its unique structure, which includes a silacyclooctane ring integrated with nitrogen atoms and methoxy groups. The presence of two methoxy groups contributes to its potential reactivity and solubility in various organic solvents. The diaza substitution indicates that there are two nitrogen atoms incorporated into the cyclooctane framework, which can influence the compound's electronic properties and steric hindrance. This compound may exhibit interesting properties such as potential coordination capabilities with metal ions, making it relevant in coordination chemistry and materials science. Additionally, the silacycloalkane structure can impart unique stability and reactivity compared to its carbon-based counterparts. Its applications could extend to fields such as organic synthesis, catalysis, or as intermediates in the development of pharmaceuticals. However, specific applications and reactivity would depend on further empirical studies and characterization.
Formula:C7H18N2O2Si
InChI:InChI=1/C7H18N2O2Si/c1-10-12(11-2)7-3-4-8-5-6-9-12/h8-9H,3-7H2,1-2H3
SMILES:CO[Si]1(CCCNCCN1)OC
Synonyms:- 2,2-Dimethoxy-1,6,2-Diazasilocane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Silicon,dimethoxy[N-(propyl-kC3)-1,2-ethanediaminato(2-)-kN,kN']-, (SP-5-12)- (9CI)
CAS:Formula:C7H18N2O2SiMolecular weight:190.31552,2-dimethoxy-1,6-diaza-2-silacyclooctane
CAS:<p>S25352 - 2,2-dimethoxy-1,6-diaza-2-silacyclooctane</p>Formula:C7H18N2O2SiColor and Shape:SolidMolecular weight:190.318


