CAS 18201-65-5

DICHLOROPHENYL-ABA

Description:

Dichlorophenyl-ABA, with the CAS number 18201-65-5, is a chemical compound that belongs to the class of phenyl compounds. It is characterized by the presence of two chlorine atoms substituted on a phenyl ring, which influences its chemical reactivity and physical properties. This compound typically exhibits a solid state at room temperature and is often used in various applications, including as a herbicide or in agricultural practices due to its ability to affect plant growth. The dichlorophenyl group contributes to its lipophilicity, allowing it to interact with biological membranes. Additionally, the presence of the ABA (abscisic acid) moiety suggests potential roles in plant hormone activity, influencing processes such as seed dormancy and stress responses. Safety and handling precautions are essential due to the potential toxicity associated with chlorinated compounds. Overall, dichlorophenyl-ABA is a compound of interest in both agricultural and biochemical research contexts, warranting further investigation into its environmental impact and efficacy.

Formula: C₁₃H₉Cl₂NO₂

InChI: InChI=1/C13H9Cl2NO2/c14-8-5-9(15)7-10(6-8)16-12-4-2-1-3-11(12)13(17)18/h1-7,16H,(H,17,18)

SMILES: c1ccc(c(c1)C(=O)O)Nc1cc(cc(c1)Cl)Cl

Synonyms:

• Benzoic Acid, 2-[(3,5-Dichlorophenyl)Amino]-
• 2-[(3,5-Dichlorophenyl)Amino]Benzoic Acid

2-((3,5-Dichlorophenyl)amino)benzoic acid

CAS: 18201-65-5

2-((3,5-Dichlorophenyl)amino)benzoic acid

Purity: 98%

Molecular weight: 282.13g/mol

Ref: 54-OR1074835

Dichlorophenyl-ABA

CAS: 18201-65-5

Dichlorophenyl-ABA is a transthyretin (TTR) amyloid fibril formation inhibitor. It inhibits aggregate formation in more than 80% in TTR L55P-expressing cells.

Formula: C₁₃H₉Cl₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 282.12

Ref: TM-T15116