CAS 1820574-47-7

(2S,4S)-4-Fluoro-N-methyl-1-[(4-methyl-5-thiazolyl)methyl]-2-pyrrolidinemethanamine

Description:

(2S,4S)-4-Fluoro-N-methyl-1-[(4-methyl-5-thiazolyl)methyl]-2-pyrrolidinemethanamine is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a thiazole moiety, contributing to its biological activity. The presence of a fluorine atom at the 4-position of the pyrrolidine ring enhances its lipophilicity and may influence its interaction with biological targets. The N-methyl group indicates that it has a tertiary amine, which can participate in hydrogen bonding and affect its pharmacokinetic properties. This compound is likely to exhibit specific pharmacological effects, potentially related to its structural features, making it of interest in medicinal chemistry. Its CAS number, 1820574-47-7, allows for precise identification in chemical databases and literature. Overall, the unique combination of its functional groups and stereochemistry suggests potential applications in drug development, particularly in targeting neurological or psychiatric conditions.

Formula: C₁₁H₁₈FN₃S

InChI: InChI=1S/C11H18FN3S/c1-8-11(16-7-14-8)6-15-5-9(12)3-10(15)4-13-2/h7,9-10,13H,3-6H2,1-2H3/t9-,10-/m0/s1

InChI key: InChIKey=BRAOFWDNFJKUMG-UWVGGRQHSA-N

SMILES: C(N1[C@H](CNC)C[C@H](F)C1)C2=C(C)N=CS2

Synonyms:

• (2S,4S)-4-Fluoro-N-methyl-1-[(4-methyl-5-thiazolyl)methyl]-2-pyrrolidinemethanamine
• 2-Pyrrolidinemethanamine, 4-fluoro-N-methyl-1-[(4-methyl-5-thiazolyl)methyl]-, (2S,4S)-

{[(2S,4S)-4-Fluoro-1-[(4-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methyl}(methyl)amine

CAS: 1820574-47-7

Versatile small molecule scaffold

Formula: C₁₁H₁₈FN₃S

Purity: Min. 95%

Molecular weight: 243.35 g/mol

Ref: 3D-VXC57447