CAS 1820583-38-7

3-Piperidinecarboxylic acid, 4-hydroxy-1-methyl-, hydrate (1:1), (3R,4R)-

Description:

3-Piperidinecarboxylic acid, 4-hydroxy-1-methyl-, hydrate (1:1), (3R,4R)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and a hydroxyl group, contributing to its potential as a biologically active molecule. The presence of the methyl group at the 1-position and the specific stereochemistry at the 3 and 4 positions (designated as (3R,4R)-) indicates that it has specific spatial arrangements that may influence its reactivity and interactions with biological systems. As a hydrate, it exists in a form that includes water molecules, which can affect its solubility and stability. This compound may be of interest in pharmaceutical research due to its structural features, which could be relevant for drug design or as a biochemical probe. Its CAS number, 1820583-38-7, allows for precise identification in chemical databases and literature.

Formula: C₇H₁₃NO₃·H₂O

InChI: InChI=1S/C7H13NO3.H2O/c1-8-3-2-6(9)5(4-8)7(10)11;/h5-6,9H,2-4H2,1H3,(H,10,11);1H2/t5-,6-;/m1./s1

InChI key: InChIKey=HCXGWSIUWQQXPX-KGZKBUQUSA-N

SMILES: C(O)(=O)[C@H]1[C@H](O)CCN(C)C1.O

Synonyms:

• 3-Piperidinecarboxylic acid, 4-hydroxy-1-methyl-, hydrate (1:1), (3R,4R)-

(3R,4R)-4-hydroxy-1-methyl-3-piperidinecarboxylic acid hydrate

CAS: 1820583-38-7

Formula: C₇H₁₅NO₄

Purity: 95.0%

Molecular weight: 177.2

Ref: 10-F359007