
CAS 1820583-39-8
:(cis-3-Ethoxycyclobutyl)hydrazine
Description:
(cis-3-Ethoxycyclobutyl)hydrazine is a chemical compound characterized by its unique structural features, including a cyclobutane ring and an ethoxy group attached to a hydrazine moiety. The cis configuration indicates that the ethoxy group and the hydrazine are oriented on the same side of the cyclobutane ring, which can influence the compound's reactivity and physical properties. This compound may exhibit properties typical of hydrazines, such as being a potential reducing agent and having applications in organic synthesis. Its molecular structure suggests it could participate in various chemical reactions, including those involving nucleophilic attack due to the presence of the hydrazine functional group. Additionally, the ethoxy group may enhance solubility in organic solvents and influence the compound's overall stability. As with many hydrazine derivatives, safety considerations are paramount due to potential toxicity and reactivity, necessitating careful handling and storage. Further studies would be required to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C6H14N2O
InChI:InChI=1/C6H14N2O/c1-2-9-6-3-5(4-6)8-7/h5-6,8H,2-4,7H2,1H3/t5-,6+
InChI key:InChIKey=QSNOVFKYDUZEOS-OLQVQODUNA-N
SMILES:O(CC)[C@H]1C[C@@H](NN)C1
Synonyms:- (cis-3-Ethoxycyclobutyl)hydrazine
- Hydrazine, (cis-3-ethoxycyclobutyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.