CAS 1820587-63-0

2(3H)-Benzothiazolimine, 6-chloro-3-(2-propen-1-yl)-, hydrobromide (1:1)

Description:

2(3H)-Benzothiazolimine, 6-chloro-3-(2-propen-1-yl)-, hydrobromide (1:1) is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a propenyl group. The presence of a chlorine atom at the 6-position of the benzothiazole ring contributes to its reactivity and potential biological activity. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, which can enhance its applicability in various chemical and pharmaceutical contexts. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, this compound represents a class of heterocyclic compounds with diverse applications in chemistry and pharmacology.

Formula: C₁₀H₉ClN₂S·BrH

InChI: InChI=1S/C10H9ClN2S.BrH/c1-2-5-13-8-4-3-7(11)6-9(8)14-10(13)12;/h2-4,6,12H,1,5H2;1H

InChI key: InChIKey=KPBYQCKNGKVMMA-UHFFFAOYSA-N

SMILES: C(C=C)N1C=2C(SC1=N)=CC(Cl)=CC2.Br

Synonyms:

• 2(3H)-Benzothiazolimine, 6-chloro-3-(2-propen-1-yl)-, hydrobromide (1:1)

3-allyl-6-chlorobenzo[d]thiazol-2(3H)-imine hydrobromide

CAS: 1820587-63-0

Formula: C₁₀H₁₀BrClN₂S

Purity: 95.0%

Molecular weight: 305.62

Ref: 10-F495387