CAS 1820590-29-1

1,3-Dioxolo[4,5-f]benzothiazol-6(7H)-imine, 7-(2-propyn-1-yl)-, hydrobromide (1:1)

Description:

1,3-Dioxolo[4,5-f]benzothiazol-6(7H)-imine, 7-(2-propyn-1-yl)-, hydrobromide (1:1) is a chemical compound characterized by its unique structural features, which include a benzothiazole core fused with a dioxole ring and an imine functional group. The presence of a propynyl substituent at the 7-position enhances its reactivity and potential applications in organic synthesis. As a hydrobromide salt, it is typically more soluble in polar solvents, which can facilitate its use in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, although specific biological properties would require further investigation. Its molecular structure suggests potential for interactions with biological targets, possibly influencing its pharmacological profile. The compound's CAS number, 1820590-29-1, allows for precise identification and retrieval of information regarding its properties, safety data, and applications in scientific literature. Overall, this compound represents a fascinating area of study within the realm of heterocyclic chemistry and drug development.

Formula: C₁₁H₈N₂O₂S·BrH

InChI: InChI=1S/C11H8N2O2S.BrH/c1-2-3-13-7-4-8-9(15-6-14-8)5-10(7)16-11(13)12;/h1,4-5,12H,3,6H2;1H

InChI key: InChIKey=ZPKVFETZOUUDBH-UHFFFAOYSA-N

SMILES: C(C#C)N1C=2C(=CC3=C(C2)OCO3)SC1=N.Br

Synonyms:

• 1,3-Dioxolo[4,5-f]benzothiazol-6(7H)-imine, 7-(2-propyn-1-yl)-, hydrobromide (1:1)

7-(prop-2-yn-1-yl)-[1,3]dioxolo[4′,5′:4,5]benzo[1,2-d]thiazol-6(7H)-imine hydrobromide

CAS: 1820590-29-1

Formula: C₁₁H₉BrN₂O₂S

Purity: 95.0%

Molecular weight: 313.17

Ref: 10-F495383