CAS 1820604-20-3

Benzothiazole, 5,7-dimethyl-2-(1-piperazinyl)-, hydrochloride (1:1)

Description:

Benzothiazole, 5,7-dimethyl-2-(1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its benzothiazole core, which is a bicyclic structure containing both a benzene ring and a thiazole ring. The presence of the 5,7-dimethyl groups contributes to its hydrophobic properties, while the piperazine moiety enhances its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceuticals. This compound may exhibit pharmacological properties, potentially acting as a ligand or modulator in biological systems. Its molecular structure suggests it could interact with various biological targets, which may be of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic applications.

Formula: C₁₃H₁₇N₃S·ClH

InChI: InChI=1S/C13H17N3S.ClH/c1-9-7-10(2)12-11(8-9)15-13(17-12)16-5-3-14-4-6-16;/h7-8,14H,3-6H2,1-2H3;1H

InChI key: InChIKey=PSIQVHXEIUWQGA-UHFFFAOYSA-N

SMILES: CC1=C2C(N=C(S2)N3CCNCC3)=CC(C)=C1.Cl

Synonyms:

• Benzothiazole, 5,7-dimethyl-2-(1-piperazinyl)-, hydrochloride (1:1)

5,7-dimethyl-2-piperazin-1-yl-1,3-benzothiazole hydrochloride

CAS: 1820604-20-3

Formula: C₁₃H₁₈ClN₃S

Purity: 95.0%

Molecular weight: 283.82

Ref: 10-F495478