CAS 1820607-90-6

1,1-Dimethylethyl 3-oxo-1,2,7-triazaspiro[4.4]nonane-7-carboxylate

Description:

1,1-Dimethylethyl 3-oxo-1,2,7-triazaspiro[4.4]nonane-7-carboxylate, identified by its CAS number 1820607-90-6, is a chemical compound characterized by its unique spirocyclic structure, which incorporates a triazine moiety. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the dimethyl group enhances its steric bulk, which can influence its interaction with biological targets or other chemical species. The triazine ring system may impart specific electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound's structural complexity suggests potential applications in drug development or as a synthetic intermediate. Its stability, solubility, and reactivity would depend on the specific conditions, such as pH and temperature, under which it is studied or utilized. Overall, this compound exemplifies the diverse chemistry associated with spirocyclic compounds and their derivatives.

Formula: C₁₁H₁₉N₃O₃

InChI: InChI=1S/C11H19N3O3/c1-10(2,3)17-9(16)14-5-4-11(7-14)6-8(15)12-13-11/h13H,4-7H2,1-3H3,(H,12,15)

InChI key: InChIKey=YTJOGGJXWKYVIA-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(CC1)NNC(=O)C2

Synonyms:

• 1,2,7-Triazaspiro[4.4]nonane-7-carboxylic acid, 3-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-oxo-1,2,7-triazaspiro[4.4]nonane-7-carboxylate

tert-Butyl 3-oxo-1,2,7-triazaspiro[4.4]nonane-7-carboxylate

CAS: 1820607-90-6

Versatile small molecule scaffold

Formula: C₁₁H₁₉N₃O₃

Purity: Min. 95%

Molecular weight: 241.29 g/mol

Ref: 3D-VXC60790