CAS 1820608-36-3

1H-Tetrazole, 1-methyl-5-(3-pyrrolidinylthio)-, hydrochloride (1:1)

Description:

1H-Tetrazole, 1-methyl-5-(3-pyrrolidinylthio)-, hydrochloride (1:1) is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. This compound features a methyl group at the 1-position and a pyrrolidinylthio group at the 5-position, contributing to its unique properties and potential biological activity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. The presence of the pyrrolidinylthio moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit various pharmacological effects, although specific activities would depend on further studies. Its CAS number, 1820608-36-3, allows for precise identification in chemical databases. As with many tetrazole derivatives, it may also be explored for applications in pharmaceuticals, agrochemicals, or materials science due to its diverse reactivity and structural versatility.

Formula: C₆H₁₁N₅S·ClH

InChI: InChI=1S/C6H11N5S.ClH/c1-11-6(8-9-10-11)12-5-2-3-7-4-5;/h5,7H,2-4H2,1H3;1H

InChI key: InChIKey=BIZAGWTXJSMFHF-UHFFFAOYSA-N

SMILES: S(C=1N(C)N=NN1)C2CCNC2.Cl

Synonyms:

• 1H-Tetrazole, 1-methyl-5-(3-pyrrolidinylthio)-, hydrochloride (1:1)

1-methyl-5-(pyrrolidin-3-ylsulfanyl)-1H-1,2,3,4-tetrazole hydrochloride

CAS: 1820608-36-3

Formula: C₆H₁₂ClN₅S

Purity: 95.0%

Molecular weight: 221.71

Ref: 10-F495993