CAS 1820613-99-7

2-Butanamine, 1,1-difluoro-, hydrochloride (1:1)

Description:

2-Butanamine, 1,1-difluoro-, hydrochloride (1:1) is an organic compound characterized by the presence of a butanamine backbone with two fluorine atoms substituted at the first carbon position. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. This compound features a primary amine functional group, which can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. The difluorination introduces unique electronic and steric properties, potentially affecting its biological activity and chemical behavior. The presence of the hydrochloride indicates that it is protonated, which can enhance its solubility in polar solvents. This compound may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.

Formula: C₄H₉F₂N·ClH

InChI: InChI=1S/C4H9F2N.ClH/c1-2-3(7)4(5)6;/h3-4H,2,7H2,1H3;1H

InChI key: InChIKey=LDBUHXKNAHKAPX-UHFFFAOYSA-N

SMILES: C(C(F)F)(CC)N.Cl

Synonyms:

• 2-Butanamine, 1,1-difluoro-, hydrochloride (1:1)

1,1-Difluorobutan-2-amine hydrochloride

CAS: 1820613-99-7

Versatile small molecule scaffold

Formula: C₄H₁₀ClF₂N

Purity: Min. 95%

Molecular weight: 145.58 g/mol

Ref: 3D-VXC61399