CAS 1820618-23-2

5-[(Methylthio)methyl]-2-thiazolecarboxaldehyde

Description:

5-[(Methylthio)methyl]-2-thiazolecarboxaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a methylthio group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the aldehyde functional group indicates that it can participate in condensation reactions and serve as a precursor for further synthetic transformations. The thiazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry and agrochemicals. Its molecular structure suggests that it may exhibit properties such as antimicrobial or antifungal activity, although specific biological activities would need to be confirmed through empirical studies. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the methylthio group and the aldehyde functionality, which may affect its applications in synthesis and industry. Overall, 5-[(Methylthio)methyl]-2-thiazolecarboxaldehyde represents a versatile building block in organic synthesis.

Formula: C₆H₇NOS₂

InChI: InChI=1S/C6H7NOS2/c1-9-4-5-2-7-6(3-8)10-5/h2-3H,4H2,1H3

InChI key: InChIKey=XWAJCKHVMRMGOS-UHFFFAOYSA-N

SMILES: C(SC)C=1SC(C=O)=NC1

Synonyms:

• 5-[(Methylthio)methyl]-2-thiazolecarboxaldehyde
• 5-[(Methylsulfanyl)methyl]-1,3-thiazole-2-carboxaldehyde
• 2-Thiazolecarboxaldehyde, 5-[(methylthio)methyl]-

5-[(Methylsulfanyl)methyl]-1,3-thiazole-2-carbaldehyde

CAS: 1820618-23-2

Versatile small molecule scaffold

Formula: C₆H₇NOS₂

Purity: Min. 95%

Molecular weight: 173.3 g/mol

Ref: 3D-VXC61823