CAS 1820618-46-9: 4-(Difluoromethyl)tetrahydro-2H-pyran

Description:4-(Difluoromethyl)tetrahydro-2H-pyran is a chemical compound characterized by its tetrahydrofuran-like structure, which includes a pyran ring. This compound features a difluoromethyl group, which significantly influences its reactivity and properties. Typically, compounds with such functional groups exhibit unique polarities and can participate in various chemical reactions, including nucleophilic substitutions and additions. The presence of fluorine atoms often enhances the compound's stability and lipophilicity, making it of interest in medicinal chemistry and material science. Additionally, the tetrahydropyran ring contributes to the compound's conformational flexibility, which can affect its biological activity and interactions with other molecules. As with many fluorinated compounds, 4-(Difluoromethyl)tetrahydro-2H-pyran may also exhibit distinct solubility characteristics in organic solvents. Its specific applications and behavior in chemical reactions would depend on the context of its use, such as in pharmaceuticals or agrochemicals, where the difluoromethyl group can impart desirable properties.

Formula:C₆H₁₀F₂O

InChI:InChI=1S/C6H10F2O/c7-6(8)5-1-3-9-4-2-5/h5-6H,1-4H2

InChI key:InChIKey=AHSKIWNALOOGQZ-UHFFFAOYSA-N

SMILES:FC(F)C1CCOCC1

Synonyms:
2H-Pyran, 4-(difluoromethyl)tetrahydro-
4-(Difluoromethyl)tetrahydro-2H-pyran

Found 3 products.

Product data	Purity	Price range	Estimated delivery
4-(Difluoromethyl)tetrahydro-2H-pyran REF: 54-PC52073CAS: 1820618-46-9	By gc: 97% (Typical Value in Batch COA)	75.00 €~449.00 €	Thu 27 Mar 25
4-(Difluoromethyl)tetrahydro-2H-pyran REF: 10-F771385CAS: 1820618-46-9	98%	- - -	Discontinued product
4-(Difluoromethyl)tetrahydro-2H-pyran REF: 3D-VXC61846CAS: 1820618-46-9	Min. 95%	- - -	Discontinued product