CymitQuimica logo

CAS 1820618-84-5

:

1-Cyclopentyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxaldehyde

Description:
1-Cyclopentyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxaldehyde is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a cyclopentyl group and a trifluoromethyl group, along with an aldehyde functional group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. The aldehyde functional group is known for its reactivity, particularly in condensation reactions and as a precursor in various synthetic pathways. This compound may exhibit interesting pharmacological properties due to its structural motifs, making it a subject of interest in medicinal chemistry. Additionally, the presence of fluorine atoms often imparts unique electronic properties, potentially affecting the compound's interaction with biological targets. Overall, 1-Cyclopentyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxaldehyde represents a versatile scaffold for further chemical exploration and development in various applications, including drug discovery and agrochemicals.
Formula:C10H11F3N2O
InChI:InChI=1S/C10H11F3N2O/c11-10(12,13)9-5-8(6-16)15(14-9)7-3-1-2-4-7/h5-7H,1-4H2
InChI key:InChIKey=HMHRLQHAYLOAAK-UHFFFAOYSA-N
SMILES:C(=O)C=1N(N=C(C(F)(F)F)C1)C2CCCC2
Synonyms:
  • 1H-Pyrazole-5-carboxaldehyde, 1-cyclopentyl-3-(trifluoromethyl)-
  • 1-Cyclopentyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.