CAS 1820620-42-5

6-[(5-Methyl-2-pyridinyl)amino]-2-pyridinecarbonitrile

Description:

6-[(5-Methyl-2-pyridinyl)amino]-2-pyridinecarbonitrile, identified by its CAS number 1820620-42-5, is a chemical compound characterized by its pyridine-based structure, which includes both amino and nitrile functional groups. This compound features a 5-methyl substitution on one of the pyridine rings, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, which can affect its solubility and reactivity. The nitrile group contributes to the compound's polarity and can also serve as a site for further chemical modifications. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including anti-cancer or anti-inflammatory activities. The molecular structure and functional groups suggest that it may interact with biological targets, making it a candidate for further research in drug development. Overall, the characteristics of this compound highlight its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₂H₁₀N₄

InChI: InChI=1S/C12H10N4/c1-9-5-6-11(14-8-9)16-12-4-2-3-10(7-13)15-12/h2-6,8H,1H3,(H,14,15,16)

InChI key: InChIKey=FADNQOROOVXLSY-UHFFFAOYSA-N

SMILES: N(C=1N=C(C#N)C=CC1)C2=CC=C(C)C=N2

Synonyms:

• 6-[(5-Methyl-2-pyridinyl)amino]-2-pyridinecarbonitrile
• 2-Pyridinecarbonitrile, 6-[(5-methyl-2-pyridinyl)amino]-

6-[(5-Methylpyridin-2-yl)amino]pyridine-2-carbonitrile

CAS: 1820620-42-5

Versatile small molecule scaffold

Formula: C₁₂H₁₀N₄

Purity: Min. 95%

Molecular weight: 210.23 g/mol

Ref: 3D-VXC62042