CAS 1820642-29-2

4-Piperidinecarboxylic acid, 4-benzoyl-, ethyl ester, hydrochloride (1:1)

Description:

4-Piperidinecarboxylic acid, 4-benzoyl-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid moiety and an ethyl ester group, contributing to its solubility and reactivity. The presence of the benzoyl group enhances its aromatic characteristics and may influence its biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and organic synthesis. The compound may exhibit properties such as being a potential intermediate in the synthesis of other organic compounds or pharmaceuticals. Its specific interactions and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₅H₁₉NO₃·ClH

InChI: InChI=1S/C15H19NO3.ClH/c1-2-19-14(18)15(8-10-16-11-9-15)13(17)12-6-4-3-5-7-12;/h3-7,16H,2,8-11H2,1H3;1H

InChI key: InChIKey=RASGFYDGNWKVAP-UHFFFAOYSA-N

SMILES: C(=O)(C1(C(OCC)=O)CCNCC1)C2=CC=CC=C2.Cl

Synonyms:

• 4-Piperidinecarboxylic acid, 4-benzoyl-, ethyl ester, hydrochloride (1:1)

Ethyl 4-benzoylpiperidine-4-carboxylate hydrochloride

CAS: 1820642-29-2

Versatile small molecule scaffold

Formula: C₁₅H₂₀ClNO₃

Purity: Min. 95%

Molecular weight: 297.78 g/mol

Ref: 3D-VXC64229