CAS 1820650-25-6

Thieno[3,2-c]pyridine, 4,5,6,7-tetrahydro-5-(4-piperidinyl)-, hydrochloride (1:2)

Description:

Thieno[3,2-c]pyridine, 4,5,6,7-tetrahydro-5-(4-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which combines a thieno and pyridine moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a piperidine substituent that contributes to its pharmacological properties. The hydrochloride salt form enhances its solubility in aqueous solutions, making it suitable for various applications, particularly in medicinal chemistry. The compound is of interest for its potential biological activity, which may include effects on neurotransmitter systems, given the presence of the piperidine group. Its molecular structure allows for interactions with specific receptors, potentially leading to therapeutic effects. As with many compounds in this class, careful consideration of its synthesis, stability, and biological activity is essential for its application in research and development. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe laboratory practices.

Formula: C₁₂H₁₈N₂S·2ClH

InChI: InChI=1S/C12H18N2S.2ClH/c1-5-13-6-2-11(1)14-7-3-12-10(9-14)4-8-15-12;;/h4,8,11,13H,1-3,5-7,9H2;2*1H

InChI key: InChIKey=FBIOXHKURSVNLF-UHFFFAOYSA-N

SMILES: N1(CC2=C(CC1)SC=C2)C3CCNCC3.Cl

Synonyms:

• Thieno[3,2-c]pyridine, 4,5,6,7-tetrahydro-5-(4-piperidinyl)-, hydrochloride (1:2)

5-(piperidin-4-yl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine dihydrochloride

CAS: 1820650-25-6

Formula: C₁₂H₂₀Cl₂N₂S

Purity: 95.0%

Molecular weight: 295.27

Ref: 10-F496005