CAS 1820650-52-9

3-Pyrrolidinemethanol, 3-fluoro-4-phenyl-

Description:

3-Pyrrolidinemethanol, 3-fluoro-4-phenyl- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a hydroxymethyl group (-CH2OH) indicates that it has alcohol functionality, contributing to its potential as a polar compound. The fluorine atom at the 3-position and the phenyl group at the 4-position of the pyrrolidine ring suggest that this compound may exhibit unique electronic and steric properties, which can influence its reactivity and interactions with biological systems. Such modifications can enhance lipophilicity or alter the compound's pharmacological profile, making it of interest in medicinal chemistry. The compound's molecular structure may also suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding conditions, including pH and temperature. Safety and handling precautions should be observed due to the presence of fluorine and the potential for biological activity.

Formula: C₁₁H₁₄FNO

InChI: InChI=1S/C11H14FNO/c12-11(8-14)7-13-6-10(11)9-4-2-1-3-5-9/h1-5,10,13-14H,6-8H2

InChI key: InChIKey=OCJUAGWCCHXMJF-UHFFFAOYSA-N

SMILES: C(O)C1(F)C(CNC1)C2=CC=CC=C2

Synonyms:

• 3-Pyrrolidinemethanol, 3-fluoro-4-phenyl-

(3-Fluoro-4-phenylpyrrolidin-3-yl)methanol

CAS: 1820650-52-9

Versatile small molecule scaffold

Formula: C₁₁H₁₄FNO

Purity: Min. 95%

Molecular weight: 195.23 g/mol

Ref: 3D-VXC65052