CAS 1820664-88-7

4-Piperidinamine, 1-ethyl-4-(trifluoromethyl)-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-ethyl-4-(trifluoromethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of an ethyl group and a trifluoromethyl group at specific positions on the piperidine ring contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The trifluoromethyl group is known to influence the compound's lipophilicity and metabolic stability, making it of interest in medicinal chemistry. This compound may exhibit various biological activities, potentially acting as a pharmacological agent, although specific biological data would depend on empirical studies. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₈H₁₅F₃N₂·2ClH

InChI: InChI=1S/C8H15F3N2.2ClH/c1-2-13-5-3-7(12,4-6-13)8(9,10)11;;/h2-6,12H2,1H3;2*1H

InChI key: InChIKey=OOHIVGVWPJJDKJ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1(N)CCN(CC)CC1.Cl

Synonyms:

• 4-Piperidinamine, 1-ethyl-4-(trifluoromethyl)-, hydrochloride (1:2)

1-Ethyl-4-(trifluoromethyl)piperidin-4-amine dihydrochloride

CAS: 1820664-88-7

Versatile small molecule scaffold

Formula: C₈H₁₇Cl₂F₃N₂

Purity: Min. 95%

Molecular weight: 269.13 g/mol

Ref: 3D-VXC66488