CAS 1820666-22-5

1H-1,4-Diazepine-1-sulfonamide, hexahydro-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

Description:

1H-1,4-Diazepine-1-sulfonamide, hexahydro-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1), identified by CAS number 1820666-22-5, is a chemical compound characterized by its diazepine core structure, which consists of a seven-membered ring containing two nitrogen atoms. This compound features a sulfonamide functional group, which is known for its biological activity, particularly in medicinal chemistry. The presence of the hexahydro group indicates saturation in the ring structure, contributing to its stability and solubility. The trifluoroethyl substituent enhances lipophilicity and may influence the compound's pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound's unique structure suggests potential for specific interactions with biological targets, making it of interest in drug development. However, detailed studies on its biological activity, toxicity, and therapeutic potential would be necessary to fully understand its applications and safety profile.

Formula: C₇H₁₄F₃N₃O₂S·ClH

InChI: InChI=1S/C7H14F3N3O2S.ClH/c8-7(9,10)6-12-16(14,15)13-4-1-2-11-3-5-13;/h11-12H,1-6H2;1H

InChI key: InChIKey=SINZKOITNMNMJX-UHFFFAOYSA-N

SMILES: S(NCC(F)(F)F)(=O)(=O)N1CCCNCC1.Cl

Synonyms:

• 1H-1,4-Diazepine-1-sulfonamide, hexahydro-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

N-(2,2,2-trifluoroethyl)-1,4-diazepane-1-sulfonamide hydrochloride

CAS: 1820666-22-5

Formula: C₇H₁₅ClF₃N₃O₂S

Purity: 95.0%

Molecular weight: 297.72

Ref: 10-F494786