CAS 1820684-21-6

7-Bromo-2,4-benzoxazolediamine

Description:

7-Bromo-2,4-benzoxazolediamine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring fused with an amine group. This compound features a bromine atom at the 7-position of the benzoxazole, contributing to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of the amine functional group enhances its solubility in polar solvents and allows for further derivatization, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored for potential pharmaceutical applications. Its molecular properties, such as melting point, boiling point, and solubility, are influenced by the bromine substitution and the overall molecular structure. As with many heterocyclic compounds, 7-Bromo-2,4-benzoxazolediamine may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest for researchers in synthetic organic chemistry. Safety data and handling precautions should be considered due to the presence of bromine and the potential for biological activity.

Formula: C₇H₆BrN₃O

InChI: InChI=1S/C7H6BrN3O/c8-3-1-2-4(9)5-6(3)12-7(10)11-5/h1-2H,9H2,(H2,10,11)

InChI key: InChIKey=SUIGDINWYYWBRO-UHFFFAOYSA-N

SMILES: NC1=C2C(OC(N)=N2)=C(Br)C=C1

Synonyms:

• 7-Bromo-2,4-benzoxazolediamine
• 2,4-Benzoxazolediamine, 7-bromo-