CAS 1820684-42-1

1H-Imidazole-5-carboxylic acid, 2,4-dimethyl-, hydrochloride (1:1)

Description:

1H-Imidazole-5-carboxylic acid, 2,4-dimethyl-, hydrochloride (1:1), with CAS number 1820684-42-1, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group and two methyl groups at the 2 and 4 positions of the imidazole ring, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals and biochemistry. The presence of the carboxylic acid group suggests potential acidity, while the imidazole moiety may participate in hydrogen bonding and coordination with metal ions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can be influenced by the pH of the environment, and it may be used in research settings for studying enzyme interactions or as a building block in organic synthesis.

Formula: C₆H₈N₂O₂·ClH

InChI: InChI=1S/C6H8N2O2.ClH/c1-3-5(6(9)10)8-4(2)7-3;/h1-2H3,(H,7,8)(H,9,10);1H

InChI key: InChIKey=LTWUZQGECHXBBQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1NC(C)=NC1C.Cl

Synonyms:

• 1H-Imidazole-5-carboxylic acid, 2,4-dimethyl-, hydrochloride (1:1)

2,5-Dimethyl-1H-imidazole-4-carboxylic acid hydrochloride

CAS: 1820684-42-1

Versatile small molecule scaffold

Formula: C₆H₉ClN₂O₂

Purity: Min. 95%

Molecular weight: 176.6 g/mol

Ref: 3D-VXC68442