CAS 1820686-49-4

8-Azabicyclo[3.2.1]octane, 3-(2-pyrimidinyloxy)-, hydrochloride (1:2)

Description:

8-Azabicyclo[3.2.1]octane, 3-(2-pyrimidinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, contributing to its classification as an azabicyclic compound. The presence of a pyrimidinyloxy group indicates that it has a pyrimidine ring attached via an ether linkage, which can influence its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential for pharmaceutical applications. This compound may exhibit various pharmacological properties, potentially acting as a ligand for certain receptors or enzymes, making it of interest in medicinal chemistry. Its specific interactions and effects would depend on the structural nuances and the functional groups present. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₁H₁₅N₃O·2ClH

InChI: InChI=1S/C11H15N3O.2ClH/c1-4-12-11(13-5-1)15-10-6-8-2-3-9(7-10)14-8;;/h1,4-5,8-10,14H,2-3,6-7H2;2*1H

InChI key: InChIKey=ZZJKIPBIZYXDRQ-UHFFFAOYSA-N

SMILES: O(C1CC2NC(C1)CC2)C=3N=CC=CN3.Cl

Synonyms:

• 8-Azabicyclo[3.2.1]octane, 3-(2-pyrimidinyloxy)-, hydrochloride (1:2)

3-(pyrimidin-2-yloxy)-8-azabicyclo[3.2.1]octane dihydrochloride

CAS: 1820686-49-4

Formula: C₁₁H₁₇Cl₂N₃O

Purity: 95.0%

Molecular weight: 278.18

Ref: 10-F496019