CAS 1820687-70-4

1,3-Benzenedimethanamine, 4-methoxy-N3,N3-dimethyl-, hydrochloride (1:2)

Description:

1,3-Benzenedimethanamine, 4-methoxy-N3,N3-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its amine functional groups and aromatic structure. It features a benzene ring with two methanamine groups at the 1 and 3 positions, and a methoxy group at the 4 position, contributing to its unique reactivity and properties. The presence of dimethyl substituents on the amine groups enhances its basicity and solubility in polar solvents. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form, often exhibiting improved solubility in water. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to form complexes with other substances. Its specific applications and effects would depend on further studies and context within chemical research. Safety data and handling precautions should be observed, as with any chemical substance, particularly those involving amines and hydrochlorides.

Formula: C₁₁H₁₈N₂O·2ClH

InChI: InChI=1S/C11H18N2O.2ClH/c1-13(2)8-10-6-9(7-12)4-5-11(10)14-3;;/h4-6H,7-8,12H2,1-3H3;2*1H

InChI key: InChIKey=FBTOPEIHCHMMAO-UHFFFAOYSA-N

SMILES: C(N(C)C)C1=C(OC)C=CC(CN)=C1.Cl

Synonyms:

• 1,3-Benzenedimethanamine, 4-methoxy-N3,N3-dimethyl-, hydrochloride (1:2)

1-(5-(aminomethyl)-2-methoxyphenyl)-N,N-dimethylmethanamine dihydrochloride

CAS: 1820687-70-4

Formula: C₁₁H₂₀Cl₂N₂O

Purity: 95.0%

Molecular weight: 267.19

Ref: 10-F495100