CymitQuimica logo

CAS 1820703-24-9

:

Methyl 2′,3′,5-trichloro[1,1′-biphenyl]-3-carboxylate

Description:
Methyl 2′,3′,5-trichloro[1,1′-biphenyl]-3-carboxylate is a chemical compound characterized by its complex biphenyl structure, which features three chlorine substituents and a carboxylate ester functional group. This compound is typically a solid at room temperature and may exhibit a crystalline or amorphous form, depending on its purity and synthesis method. The presence of chlorine atoms contributes to its potential for environmental persistence and bioaccumulation, making it of interest in studies related to environmental chemistry and toxicology. The methyl ester group enhances its solubility in organic solvents, which can influence its reactivity and interactions in various chemical processes. Additionally, the compound may exhibit specific biological activities, which could be relevant in pharmacological research or agrochemical applications. As with many chlorinated compounds, it is essential to handle this substance with care due to potential health and environmental risks associated with chlorinated organic compounds.
Formula:C14H9Cl3O2
InChI:InChI=1S/C14H9Cl3O2/c1-19-14(18)9-5-8(6-10(15)7-9)11-3-2-4-12(16)13(11)17/h2-7H,1H3
InChI key:InChIKey=WEHQSQIAKXNQAL-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(C(OC)=O)=CC(Cl)=C2)C=CC=C1Cl
Synonyms:
  • Methyl 2′,3′,5-trichloro[1,1′-biphenyl]-3-carboxylate
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′,3′,5-trichloro-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.