CAS 1820704-18-4

3-Pyridazinecarboxylic acid, 6-(dimethylamino)-, hydrochloride (1:1)

Description:

3-Pyridazinecarboxylic acid, 6-(dimethylamino)-, hydrochloride (1:1) is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group and a dimethylamino substituent, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the dimethylamino group may influence its pharmacokinetic properties, such as absorption and distribution. The compound's molecular structure suggests it may participate in hydrogen bonding, which can affect its interaction with biological targets. Additionally, the specific arrangement of functional groups can impart unique reactivity and stability characteristics. Overall, this compound's properties make it of interest in medicinal chemistry and related fields, where it may serve as a lead compound for drug development or as a research tool in studying biological processes.

Formula: C₇H₉N₃O₂·ClH

InChI: InChI=1S/C7H9N3O2.ClH/c1-10(2)6-4-3-5(7(11)12)8-9-6;/h3-4H,1-2H3,(H,11,12);1H

InChI key: InChIKey=AUMNVDXRPQXRKR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=C(N(C)C)N=N1.Cl

Synonyms:

• 3-Pyridazinecarboxylic acid, 6-(dimethylamino)-, hydrochloride (1:1)

6-(dimethylamino)pyridazine-3-carboxylic acid hydrochloride

CAS: 1820704-18-4

Formula: C₇H₁₀ClN₃O₂

Purity: 95.0%

Molecular weight: 203.63

Ref: 10-F495099