
CAS 1820704-52-6
:1H-Indazol-3-amine, 5-bromo-1,7-dimethyl-
Description:
1H-Indazol-3-amine, 5-bromo-1,7-dimethyl- is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and two methyl groups at the 1 and 7 positions contributes to its unique properties. This compound is typically classified as an aromatic amine due to the amine functional group (-NH2) attached to the indazole ring. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, and its halogenated nature may influence its reactivity and solubility. Additionally, the compound's stability, melting point, and solubility in various solvents can vary based on its specific molecular interactions. Overall, 1H-Indazol-3-amine, 5-bromo-1,7-dimethyl- represents a class of compounds that can be explored for various applications in pharmaceuticals and organic synthesis.
Formula:C9H10BrN3
InChI:InChI=1S/C9H10BrN3/c1-5-3-6(10)4-7-8(5)13(2)12-9(7)11/h3-4H,1-2H3,(H2,11,12)
InChI key:InChIKey=PKSJBVLMXDSHOQ-UHFFFAOYSA-N
SMILES:NC=1C=2C(N(C)N1)=C(C)C=C(Br)C2
Synonyms:- 1H-Indazol-3-amine, 5-bromo-1,7-dimethyl-
- 5-Bromo-1,7-dimethylindazol-3-amine
- 5-Bromo-1,7-dimethyl-1H-indazol-3-amine
- 3-Amino-5-bromo-1,7-dimethylindazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.