CAS 1820707-48-9

Methanone, 3-azetidinyl-1-pyrrolidinyl-, hydrochloride (1:1)

Description:

Methanone, 3-azetidinyl-1-pyrrolidinyl-, hydrochloride (1:1), with the CAS number 1820707-48-9, is a chemical compound characterized by its unique structural features that include a methanone functional group and a combination of azetidine and pyrrolidine rings. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in laboratory settings. The presence of the azetidine and pyrrolidine moieties suggests potential biological activity, possibly influencing its pharmacological properties. As a hydrochloride salt, it is likely to exhibit stability under standard conditions, making it suitable for various applications in medicinal chemistry and research. The compound's specific interactions, reactivity, and potential uses would depend on its molecular structure and the functional groups present, which may contribute to its efficacy in biological systems. However, detailed studies would be necessary to fully elucidate its characteristics and potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₈H₁₄N₂O·ClH

InChI: InChI=1S/C8H14N2O.ClH/c11-8(7-5-9-6-7)10-3-1-2-4-10;/h7,9H,1-6H2;1H

InChI key: InChIKey=RNWTYQZOFUOKNQ-UHFFFAOYSA-N

SMILES: C(=O)(C1CNC1)N2CCCC2.Cl

Synonyms:

• Methanone, 3-azetidinyl-1-pyrrolidinyl-, hydrochloride (1:1)

azetidin-3-yl(pyrrolidin-1-yl)methanone hydrochloride

CAS: 1820707-48-9

Formula: C₈H₁₅ClN₂O

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 190.67

Ref: 10-F496403