
CAS 1820707-61-6
:Methyl 3-chloro-3′-fluoro[1,1′-biphenyl]-4-carboxylate
Description:
Methyl 3-chloro-3′-fluoro[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylate group indicates that it is an ester, specifically a methyl ester, which contributes to its reactivity and solubility properties. The chlorine and fluorine substituents on the biphenyl framework enhance its chemical stability and may influence its electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic nature of the biphenyl system, which can affect its bioavailability and interaction with biological systems. Additionally, the presence of halogen atoms can impart unique reactivity patterns, making it a potential candidate for further chemical modifications. Safety data and handling precautions should be considered, as with any halogenated organic compound, due to potential toxicity and environmental impact.
Formula:C14H10ClFO2
InChI:InChI=1S/C14H10ClFO2/c1-18-14(17)12-6-5-10(8-13(12)15)9-3-2-4-11(16)7-9/h2-8H,1H3
InChI key:InChIKey=LIVWUDIXSODBAO-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1C(OC)=O)C2=CC(F)=CC=C2
Synonyms:- Methyl 3-chloro-3′-fluoro[1,1′-biphenyl]-4-carboxylate
- [1,1′-Biphenyl]-4-carboxylic acid, 3-chloro-3′-fluoro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.