CAS 1820711-15-6

Methyl 3′-fluoro-4′-(methoxycarbonyl)[1,1′-biphenyl]-3-acetate

Description:

Methyl 3′-fluoro-4′-(methoxycarbonyl)[1,1′-biphenyl]-3-acetate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a methoxycarbonyl group at the 4′ position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The acetate functional group indicates that it is an ester, which typically influences its reactivity in nucleophilic substitution reactions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, the presence of both electron-withdrawing (fluoro and methoxycarbonyl) and electron-donating (methyl) groups can affect its electronic properties, potentially influencing its interactions in various chemical environments. Overall, Methyl 3′-fluoro-4′-(methoxycarbonyl)[1,1′-biphenyl]-3-acetate is a complex molecule with diverse applications in synthetic organic chemistry and pharmaceuticals.

Formula: C₁₇H₁₅FO₄

InChI: InChI=1S/C17H15FO4/c1-21-16(19)9-11-4-3-5-12(8-11)13-6-7-14(15(18)10-13)17(20)22-2/h3-8,10H,9H2,1-2H3

InChI key: InChIKey=QOSSEGZPZWRIHW-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(OC)=O)C2=CC(CC(OC)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-acetic acid, 3′-fluoro-4′-(methoxycarbonyl)-, methyl ester
• Methyl 3′-fluoro-4′-(methoxycarbonyl)[1,1′-biphenyl]-3-acetate
• Methyl 3-fluoro-3′-(2-methoxy-2-oxoethyl)-[1,1′-biphenyl]-4-carboxylate