CAS 1820711-57-6

2,3-Pyridinediamine, N2-(4-fluorophenyl)-, hydrochloride (1:2)

Description:

2,3-Pyridinediamine, N2-(4-fluorophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing nitrogen atoms. This compound features two amino groups (–NH2) at the 2 and 3 positions of the pyridine ring, contributing to its basicity and potential reactivity. The presence of a 4-fluorophenyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals and research. The compound may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects would depend on its concentration and the context of use. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₁₂Cl₂FN₃

InChI: InChI=1S/C11H10FN3.2ClH/c12-8-3-5-9(6-4-8)15-11-10(13)2-1-7-14-11;;/h1-7H,13H2,(H,14,15);2*1H

InChI key: InChIKey=YPKNSDRZNCGOJN-UHFFFAOYSA-N

SMILES: N(C1=C(N)C=CC=N1)C2=CC=C(F)C=C2.Cl

Synonyms:

• 2,3-Pyridinediamine, N2-(4-fluorophenyl)-, hydrochloride (1:2)
• N2-(4-Fluorophenyl)pyridine-2,3-diamine dihydrochloride

N2-(4-fluorophenyl)pyridine-2,3-diamine dihydrochloride

CAS: 1820711-57-6

Formula: C₁₁H₁₂Cl₂FN₃

Purity: 95.0%

Molecular weight: 276.14

Ref: 10-F494764