CAS 1820735-50-9

Piperidine, 2-(1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1)

Description:

Piperidine, 2-(1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a 1H-1,2,4-triazole moiety, a five-membered ring containing three nitrogen atoms, which contributes to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in medicinal chemistry. The presence of both piperidine and triazole groups suggests potential interactions with biological targets, making it of interest in drug development. The compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological effects would depend on further empirical studies. Safety data, including toxicity and handling precautions, should be consulted from reliable sources when working with this substance.

Formula: C₇H₁₂N₄·ClH

InChI: InChI=1S/C7H12N4.ClH/c1-2-4-8-6(3-1)7-9-5-10-11-7;/h5-6,8H,1-4H2,(H,9,10,11);1H

InChI key: InChIKey=WIQAWBUAPPZSFC-UHFFFAOYSA-N

SMILES: C=1(NC=NN1)C2CCCCN2.Cl

Synonyms:

• Piperidine, 2-(1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1)

2-(4H-1,2,4-Triazol-3-yl)piperidine hydrochloride

CAS: 1820735-50-9

Versatile small molecule scaffold

Formula: C₇H₁₃ClN₄

Purity: Min. 95%

Molecular weight: 188.66 g/mol

Ref: 3D-VXC73550