CAS 1820740-03-1

2,3-Pyridinediamine, N2-(3-fluorophenyl)-, hydrochloride (1:2)

Description:

2,3-Pyridinediamine, N2-(3-fluorophenyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two amino groups (-NH2) at the 2 and 3 positions of the pyridine ring, contributing to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. The presence of a 3-fluorophenyl group enhances its chemical reactivity and may influence its biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more soluble in water than its free base form, which is advantageous for various applications, including drug formulation. The compound's properties, such as melting point, solubility, and stability, can be influenced by the hydrochloride form. Overall, this substance may exhibit diverse applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways.

Formula: C₁₁H₁₀FN₃·2ClH

InChI: InChI=1S/C11H10FN3.2ClH/c12-8-3-1-4-9(7-8)15-11-10(13)5-2-6-14-11;;/h1-7H,13H2,(H,14,15);2*1H

InChI key: InChIKey=VOAVVHLUHGKBQI-UHFFFAOYSA-N

SMILES: N(C1=CC(F)=CC=C1)C2=C(N)C=CC=N2.Cl

Synonyms:

• 2,3-Pyridinediamine, N2-(3-fluorophenyl)-, hydrochloride (1:2)

N2-(3-fluorophenyl)pyridine-2,3-diamine dihydrochloride

CAS: 1820740-03-1

Formula: C₁₁H₁₂Cl₂FN₃

Purity: 95.0%

Molecular weight: 276.14

Ref: 10-F494765