CAS 1820748-73-9

2-[[(4,5-Dihydro-2-thiazolyl)amino]methylene]propanedioic acid

Description:

2-[[(4,5-Dihydro-2-thiazolyl)amino]methylene]propanedioic acid, identified by its CAS number 1820748-73-9, is a chemical compound characterized by its unique thiazole ring structure and the presence of a methylene bridge connecting to a propanedioic acid moiety. This compound typically exhibits properties associated with both thiazole derivatives and dicarboxylic acids, such as potential acidity due to the carboxylic acid groups and the ability to participate in various chemical reactions, including condensation and substitution reactions. The thiazole ring contributes to its biological activity, making it of interest in medicinal chemistry for potential therapeutic applications. Additionally, the compound may exhibit solubility in polar solvents, which is common for similar organic acids. Its structural features suggest that it could engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₇H₈N₂O₄S

InChI: InChI=1S/C7H8N2O4S/c10-5(11)4(6(12)13)3-9-7-8-1-2-14-7/h3H,1-2H2,(H,8,9)(H,10,11)(H,12,13)

InChI key: InChIKey=CYBJMBDYGDZDLY-UHFFFAOYSA-N

SMILES: C(=CNC1=NCCS1)(C(O)=O)C(O)=O

Synonyms:

• Propanedioic acid, 2-[[(4,5-dihydro-2-thiazolyl)amino]methylene]-
• 2-[[(4,5-Dihydro-2-thiazolyl)amino]methylene]propanedioic acid