CAS 1821-20-1: (3E)-3-[ethoxy(hydroxy)methylidene]-2H-chromene-2,4(3H)-dione

Description: The chemical substance known as (3E)-3-[ethoxy(hydroxy)methylidene]-2H-chromene-2,4(3H)-dione, with the CAS number 1821-20-1, is a chromone derivative characterized by its unique structural features. This compound contains a chromene core, which is a bicyclic structure comprising a benzene ring fused to a pyran ring. The presence of an ethoxy group and a hydroxy group contributes to its reactivity and solubility properties. The compound exhibits potential biological activities, which may include antioxidant and anti-inflammatory effects, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions with biological targets, and it may participate in hydrogen bonding due to the hydroxyl group. Additionally, the compound's stability and reactivity can be influenced by the substituents on the chromene ring, which can affect its chemical behavior in different environments. Overall, this substance represents a class of compounds that are valuable in medicinal chemistry and organic synthesis.

Formula: C₁₂H₁₀O₅

InChI: InChI=1/C12H10O5/c1-2-16-11(14)9-10(13)7-5-3-4-6-8(7)17-12(9)15/h3-6,14H,2H2,1H3/b11-9+

2H-1-Benzopyran-3-carboxylic acid, 4-hydroxy-2-oxo-, ethyl ester

CAS: 1821-20-1

• Formula: C₁₂H₁₀O₅
• Molecular weight: 234.2048

4-Hydroxy-2-oxo-2H-1-benzopyran-3-carboxylic acid ethyl ester

CAS: 1821-20-1

4-Hydroxy-2-oxo-2H-1-benzopyran-3-carboxylic acid ethyl ester is a synthetic compound that can be used as an anticoagulant. …

• Purity: Min. 95%